C18H32O2 — CID 86006444
2-nona-3,6-dienoxy-5-pentyloxolane (PubChem CID 86006444) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 2-nona-3,6-dienoxy-5-pentyloxolane.
| Compound Name | 2-nona-3,6-dienoxy-5-pentyloxolane |
|---|---|
| PubChem CID | 86006444 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2-nona-3,6-dienoxy-5-pentyloxolane |
| SMILES | CCC=CCC=CCCOC1CCC(CCCCC)O1 |
| InChI | InChI=1S/C18H32O2/c1-3-5-7-8-9-10-12-16-19-18-15-14-17(20-18)13-11-6-4-2/h5,7,9-10,17-18H,3-4,6,8,11-16H2,1-2H3 |
| InChIKey | NOWSFOHDHMDSDK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|