C32H44N2S4 — CID 101449342
4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-5-thiophen-2-yl-1,3-thiazole (PubChem CID 101449342) has the molecular formula C32H44N2S4 and a molecular weight of 584.99 g/mol. Its IUPAC name is 4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-5-thiophen-2-yl-1,3-thiazole.
| Compound Name | 4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-5-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 101449342 |
| Molecular Formula | C32H44N2S4 |
| Molecular Weight | 584.99 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-5-thiophen-2-yl-1,3-thiazole |
| SMILES | CCCCCCCCCc1nc(-c2nc(CCCCCCCCC)c(-c3cccs3)s2)sc1-c1cccs1 |
| InChI | InChI=1S/C32H44N2S4/c1-3-5-7-9-11-13-15-19-25-29(27-21-17-23-35-27)37-31(33-25)32-34-26(20-16-14-12-10-8-6-4-2)30(38-32)28-22-18-24-36-28/h17-18,21-24H,3-16,19-20H2,1-2H3 |
| InChIKey | WLGXDUQZJKRCIB-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.99 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|