C44H54S6 — CID 54105349
2,3-didecyl-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene (PubChem CID 54105349) has the molecular formula C44H54S6 and a molecular weight of 775.32 g/mol. Its IUPAC name is 2,3-didecyl-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene.
| Compound Name | 2,3-didecyl-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 54105349 |
| Molecular Formula | C44H54S6 |
| Molecular Weight | 775.32 g/mol |
| Exact Mass | 774.25 |
| IUPAC Name | 2,3-didecyl-4-thiophen-2-yl-5-(3,4,5-trithiophen-2-ylthiophen-2-yl)thiophene |
| SMILES | CCCCCCCCCCc1sc(-c2sc(-c3cccs3)c(-c3cccs3)c2-c2cccs2)c(-c2cccs2)c1CCCCCCCCCC |
| InChI | InChI=1S/C44H54S6/c1-3-5-7-9-11-13-15-17-23-33-34(24-18-16-14-12-10-8-6-4-2)49-43(39(33)35-25-19-29-45-35)44-41(37-27-21-31-47-37)40(36-26-20-30-46-36)42(50-44)38-28-22-32-48-38/h19-22,25-32H,3-18,23-24H2,1-2H3 |
| InChIKey | NDIXROPGFKLCRR-UHFFFAOYSA-N |
| XLogP | 17.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.32 |
| LogP ≤ 5 | 17.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|