C36H31F5O2S4 — CID 90313177
5,9-dihexyl-4-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-10-thiophen-2-yl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-one (PubChem CID 90313177) has the molecular formula C36H31F5O2S4 and a molecular weight of 718.90 g/mol. Its IUPAC name is 5,9-dihexyl-4-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-10-thiophen-2-yl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-one.
| Compound Name | 5,9-dihexyl-4-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-10-thiophen-2-yl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-one |
|---|---|
| PubChem CID | 90313177 |
| Molecular Formula | C36H31F5O2S4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.11 |
| IUPAC Name | 5,9-dihexyl-4-[5-(2,3,4,5,6-pentafluorobenzoyl)thiophen-2-yl]-10-thiophen-2-yl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-one |
| SMILES | CCCCCCc1c(-c2cccs2)sc2c1C(=O)c1c-2sc(-c2ccc(C(=O)c3c(F)c(F)c(F)c(F)c3F)s2)c1CCCCCC |
| InChI | InChI=1S/C36H31F5O2S4/c1-3-5-7-9-12-18-23-32(43)24-19(13-10-8-6-4-2)34(47-36(24)35(23)46-33(18)21-14-11-17-44-21)22-16-15-20(45-22)31(42)25-26(37)28(39)30(41)29(40)27(25)38/h11,14-17H,3-10,12-13H2,1-2H3 |
| InChIKey | JAEOACKBSLEMDF-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|