C58H61N6O3PRuS3 — CID 59841640
4-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-2,6-dipyridin-2-ylpyridine;(2,6-dipyridin-2-yl-4-pyridinyl)phosphonic acid;ruthenium (PubChem CID 59841640) has the molecular formula C58H61N6O3PRuS3 and a molecular weight of 1118.41 g/mol. Its IUPAC name is 4-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-2,6-dipyridin-2-ylpyridine;(2,6-dipyridin-2-yl-4-pyridinyl)phosphonic acid;ruthenium.
| Compound Name | 4-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-2,6-dipyridin-2-ylpyridine;(2,6-dipyridin-2-yl-4-pyridinyl)phosphonic acid;ruthenium |
|---|---|
| PubChem CID | 59841640 |
| Molecular Formula | C58H61N6O3PRuS3 |
| Molecular Weight | 1118.41 g/mol |
| Exact Mass | 1118.27 |
| IUPAC Name | 4-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-2,6-dipyridin-2-ylpyridine;(2,6-dipyridin-2-yl-4-pyridinyl)phosphonic acid;ruthenium |
| SMILES | CCCCCCCCc1c(-c2cccs2)sc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)s2)c1CCCCCCCC.O=P(O)(O)c1cc(-c2ccccn2)nc(-c2ccccn2)c1.[Ru] |
| InChI | InChI=1S/C43H49N3S3.C15H12N3O3P.Ru/c1-3-5-7-9-11-13-20-33-34(21-14-12-10-8-6-4-2)43(49-42(33)40-24-19-29-47-40)41-26-25-39(48-41)32-30-37(35-22-15-17-27-44-35)46-38(31-32)36-23-16-18-28-45-36;19-22(20,21)11-9-14(12-5-1-3-7-16-12)18-15(10-11)13-6-2-4-8-17-13;/h15-19,22-31H,3-14,20-21H2,1-2H3;1-10H,(H2,19,20,21); |
| InChIKey | JVJQRFLNWLMPNR-UHFFFAOYSA-N |
| XLogP | 16.20 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.41 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|