C37H42N4S — CID 132522913
4-[5-(2,6-dipyridin-2-yl-4-pyridinyl)thiophen-2-yl]-N,N-dihexylaniline (PubChem CID 132522913) has the molecular formula C37H42N4S and a molecular weight of 574.84 g/mol. Its IUPAC name is 4-[5-(2,6-dipyridin-2-yl-4-pyridinyl)thiophen-2-yl]-N,N-dihexylaniline.
| Compound Name | 4-[5-(2,6-dipyridin-2-yl-4-pyridinyl)thiophen-2-yl]-N,N-dihexylaniline |
|---|---|
| PubChem CID | 132522913 |
| Molecular Formula | C37H42N4S |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 4-[5-(2,6-dipyridin-2-yl-4-pyridinyl)thiophen-2-yl]-N,N-dihexylaniline |
| SMILES | CCCCCCN(CCCCCC)c1ccc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)s2)cc1 |
| InChI | InChI=1S/C37H42N4S/c1-3-5-7-13-25-41(26-14-8-6-4-2)31-19-17-29(18-20-31)36-21-22-37(42-36)30-27-34(32-15-9-11-23-38-32)40-35(28-30)33-16-10-12-24-39-33/h9-12,15-24,27-28H,3-8,13-14,25-26H2,1-2H3 |
| InChIKey | LUBOGILFVNLIRI-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|