C32H29N3 — CID 102285926
N-butyl-N-phenyl-4-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)aniline (PubChem CID 102285926) has the molecular formula C32H29N3 and a molecular weight of 455.61 g/mol. Its IUPAC name is N-butyl-N-phenyl-4-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)aniline.
| Compound Name | N-butyl-N-phenyl-4-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)aniline |
|---|---|
| PubChem CID | 102285926 |
| Molecular Formula | C32H29N3 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N-butyl-N-phenyl-4-(2-phenyl-6-pyridin-2-yl-4-pyridinyl)aniline |
| SMILES | CCCCN(c1ccccc1)c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C32H29N3/c1-2-3-22-35(28-14-8-5-9-15-28)29-19-17-25(18-20-29)27-23-31(26-12-6-4-7-13-26)34-32(24-27)30-16-10-11-21-33-30/h4-21,23-24H,2-3,22H2,1H3 |
| InChIKey | HKNFMVXUZWGJSM-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |