C39H40N4 — CID 101378722
N,N-dibutyl-4-[(1E,3E)-4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]buta-1,3-dienyl]aniline (PubChem CID 101378722) has the molecular formula C39H40N4 and a molecular weight of 564.78 g/mol. Its IUPAC name is N,N-dibutyl-4-[(1E,3E)-4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]buta-1,3-dienyl]aniline.
| Compound Name | N,N-dibutyl-4-[(1E,3E)-4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 101378722 |
| Molecular Formula | C39H40N4 |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | N,N-dibutyl-4-[(1E,3E)-4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]buta-1,3-dienyl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/C=C/c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1 |
| InChI | InChI=1S/C39H40N4/c1-3-5-27-43(28-6-4-2)35-23-19-32(20-24-35)14-8-7-13-31-17-21-33(22-18-31)34-29-38(36-15-9-11-25-40-36)42-39(30-34)37-16-10-12-26-41-37/h7-26,29-30H,3-6,27-28H2,1-2H3/b13-7+,14-8+ |
| InChIKey | WXIUILOECNVZNT-FNCQTZNRSA-N |
| XLogP | 10.01 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|