C45H52BrN3O2 — CID 102087876
4-[4-[(E)-2-(4-bromo-2,5-dioctoxyphenyl)ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 102087876) has the molecular formula C45H52BrN3O2 and a molecular weight of 746.83 g/mol. Its IUPAC name is 4-[4-[(E)-2-(4-bromo-2,5-dioctoxyphenyl)ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-[(E)-2-(4-bromo-2,5-dioctoxyphenyl)ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102087876 |
| Molecular Formula | C45H52BrN3O2 |
| Molecular Weight | 746.83 g/mol |
| Exact Mass | 745.32 |
| IUPAC Name | 4-[4-[(E)-2-(4-bromo-2,5-dioctoxyphenyl)ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | CCCCCCCCOc1cc(/C=C/c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)c(OCCCCCCCC)cc1Br |
| InChI | InChI=1S/C45H52BrN3O2/c1-3-5-7-9-11-17-29-50-44-34-39(46)45(51-30-18-12-10-8-6-4-2)33-37(44)26-23-35-21-24-36(25-22-35)38-31-42(40-19-13-15-27-47-40)49-43(32-38)41-20-14-16-28-48-41/h13-16,19-28,31-34H,3-12,17-18,29-30H2,1-2H3/b26-23+ |
| InChIKey | LQBCGDURYOWMSG-WNAAXNPUSA-N |
| XLogP | 13.28 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.83 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|