C58H57N3O3 — CID 11843862
4-[(E)-2-[4-[(E)-2-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-2,5-dipropylphenyl]ethenyl]phenyl]ethenyl]-2,5-dipropoxybenzaldehyde (PubChem CID 11843862) has the molecular formula C58H57N3O3 and a molecular weight of 844.11 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-2,5-dipropylphenyl]ethenyl]phenyl]ethenyl]-2,5-dipropoxybenzaldehyde.
| Compound Name | 4-[(E)-2-[4-[(E)-2-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-2,5-dipropylphenyl]ethenyl]phenyl]ethenyl]-2,5-dipropoxybenzaldehyde |
|---|---|
| PubChem CID | 11843862 |
| Molecular Formula | C58H57N3O3 |
| Molecular Weight | 844.11 g/mol |
| Exact Mass | 843.44 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-2,5-dipropylphenyl]ethenyl]phenyl]ethenyl]-2,5-dipropoxybenzaldehyde |
| SMILES | CCCOc1cc(/C=C/c2ccc(/C=C/c3cc(CCC)c(/C=C/c4ccc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc4)cc3CCC)cc2)c(OCCC)cc1C=O |
| InChI | InChI=1S/C58H57N3O3/c1-5-13-46-36-49(29-24-44-21-26-45(27-22-44)51-37-55(53-15-9-11-31-59-53)61-56(38-51)54-16-10-12-32-60-54)47(14-6-2)35-48(46)28-23-42-17-19-43(20-18-42)25-30-50-39-58(64-34-8-4)52(41-62)40-57(50)63-33-7-3/h9-12,15-32,35-41H,5-8,13-14,33-34H2,1-4H3/b28-23+,29-24+,30-25+ |
| InChIKey | GBEIWEDOCBYMNH-SEYKETBGSA-N |
| XLogP | 14.68 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.11 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|