C53H55N3O2S — CID 102147236
4-[4-[(E)-2-[2-[2-(4-ethynyl-2,5-dioctoxyphenyl)ethynyl]thiophen-3-yl]ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 102147236) has the molecular formula C53H55N3O2S and a molecular weight of 798.11 g/mol. Its IUPAC name is 4-[4-[(E)-2-[2-[2-(4-ethynyl-2,5-dioctoxyphenyl)ethynyl]thiophen-3-yl]ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-[(E)-2-[2-[2-(4-ethynyl-2,5-dioctoxyphenyl)ethynyl]thiophen-3-yl]ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102147236 |
| Molecular Formula | C53H55N3O2S |
| Molecular Weight | 798.11 g/mol |
| Exact Mass | 797.40 |
| IUPAC Name | 4-[4-[(E)-2-[2-[2-(4-ethynyl-2,5-dioctoxyphenyl)ethynyl]thiophen-3-yl]ethenyl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | C#Cc1cc(OCCCCCCCC)c(C#Cc2sccc2/C=C/c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1OCCCCCCCC |
| InChI | InChI=1S/C53H55N3O2S/c1-4-7-9-11-13-19-34-57-51-40-45(52(39-42(51)6-3)58-35-20-14-12-10-8-5-2)29-30-53-44(31-36-59-53)28-25-41-23-26-43(27-24-41)46-37-49(47-21-15-17-32-54-47)56-50(38-46)48-22-16-18-33-55-48/h3,15-18,21-28,31-33,36-40H,4-5,7-14,19-20,34-35H2,1-2H3/b28-25+ |
| InChIKey | JVDJSSGGZVVWCM-AZPGRJICSA-N |
| XLogP | 13.96 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.11 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|