C29H30N4O — CID 177491389
N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]octanamide (PubChem CID 177491389) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]octanamide.
| Compound Name | N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]octanamide |
|---|---|
| PubChem CID | 177491389 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C29H30N4O/c1-2-3-4-5-6-13-29(34)32-24-16-14-22(15-17-24)23-20-27(25-11-7-9-18-30-25)33-28(21-23)26-12-8-10-19-31-26/h7-12,14-21H,2-6,13H2,1H3,(H,32,34) |
| InChIKey | FLVRAVXMSZERPA-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|