C27H30N4O3 — CID 4913337
3-[[4-(octanoylamino)benzoyl]amino]-N-pyridin-2-ylbenzamide (PubChem CID 4913337) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[[4-(octanoylamino)benzoyl]amino]-N-pyridin-2-ylbenzamide.
| Compound Name | 3-[[4-(octanoylamino)benzoyl]amino]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 4913337 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 3-[[4-(octanoylamino)benzoyl]amino]-N-pyridin-2-ylbenzamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(C(=O)Nc2cccc(C(=O)Nc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C27H30N4O3/c1-2-3-4-5-6-13-25(32)29-22-16-14-20(15-17-22)26(33)30-23-11-9-10-21(19-23)27(34)31-24-12-7-8-18-28-24/h7-12,14-19H,2-6,13H2,1H3,(H,29,32)(H,30,33)(H,28,31,34) |
| InChIKey | IYTAKPNKXLNLJP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|