C69H64N6 — CID 89022451
4-[4-[7-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-9,9-diheptylfluoren-2-yl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 89022451) has the molecular formula C69H64N6 and a molecular weight of 977.31 g/mol. Its IUPAC name is 4-[4-[7-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-9,9-diheptylfluoren-2-yl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-[7-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-9,9-diheptylfluoren-2-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 89022451 |
| Molecular Formula | C69H64N6 |
| Molecular Weight | 977.31 g/mol |
| Exact Mass | 976.52 |
| IUPAC Name | 4-[4-[7-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-9,9-diheptylfluoren-2-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | CCCCCCCC1(CCCCCCC)c2cc(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)ccc2-c2ccc(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)cc21 |
| InChI | InChI=1S/C69H64N6/c1-3-5-7-9-15-37-69(38-16-10-8-6-4-2)59-43-53(49-25-29-51(30-26-49)55-45-65(61-21-11-17-39-70-61)74-66(46-55)62-22-12-18-40-71-62)33-35-57(59)58-36-34-54(44-60(58)69)50-27-31-52(32-28-50)56-47-67(63-23-13-19-41-72-63)75-68(48-56)64-24-14-20-42-73-64/h11-14,17-36,39-48H,3-10,15-16,37-38H2,1-2H3 |
| InChIKey | MQQGOTJKIWRSAD-UHFFFAOYSA-N |
| XLogP | 18.38 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.31 |
| LogP ≤ 5 | 18.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|