C36H38S6 — CID 90025368
3,4-dihexyl-2-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene (PubChem CID 90025368) has the molecular formula C36H38S6 and a molecular weight of 663.10 g/mol. Its IUPAC name is 3,4-dihexyl-2-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene.
| Compound Name | 3,4-dihexyl-2-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 90025368 |
| Molecular Formula | C36H38S6 |
| Molecular Weight | 663.10 g/mol |
| Exact Mass | 662.13 |
| IUPAC Name | 3,4-dihexyl-2-[5-[5-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene |
| SMILES | CCCCCCc1csc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6cccs6)s5)s4)s3)s2)c1CCCCCC |
| InChI | InChI=1S/C36H38S6/c1-3-5-7-9-12-25-24-38-36(26(25)13-10-8-6-4-2)35-22-21-34(42-35)33-20-19-32(41-33)31-18-17-30(40-31)29-16-15-28(39-29)27-14-11-23-37-27/h11,14-24H,3-10,12-13H2,1-2H3 |
| InChIKey | UGLCJOPAMGGQLE-UHFFFAOYSA-N |
| XLogP | 14.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.10 |
| LogP ≤ 5 | 14.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|