C42H38N4S6 — CID 59467686
2,12-dihexyl-7,17-bis(5-thiophen-2-ylthiophen-2-yl)-6,16-dithia-4,10,14,20-tetrazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),7,10,12,14,17,19-nonaene (PubChem CID 59467686) has the molecular formula C42H38N4S6 and a molecular weight of 791.20 g/mol. Its IUPAC name is 2,12-dihexyl-7,17-bis(5-thiophen-2-ylthiophen-2-yl)-6,16-dithia-4,10,14,20-tetrazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),7,10,12,14,17,19-nonaene.
| Compound Name | 2,12-dihexyl-7,17-bis(5-thiophen-2-ylthiophen-2-yl)-6,16-dithia-4,10,14,20-tetrazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),7,10,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 59467686 |
| Molecular Formula | C42H38N4S6 |
| Molecular Weight | 791.20 g/mol |
| Exact Mass | 790.14 |
| IUPAC Name | 2,12-dihexyl-7,17-bis(5-thiophen-2-ylthiophen-2-yl)-6,16-dithia-4,10,14,20-tetrazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3,5(9),7,10,12,14,17,19-nonaene |
| SMILES | CCCCCCc1c2nc3cc(-c4ccc(-c5cccs5)s4)sc3nc2c(CCCCCC)c2nc3cc(-c4ccc(-c5cccs5)s4)sc3nc12 |
| InChI | InChI=1S/C42H38N4S6/c1-3-5-7-9-13-25-37-40(46-42-27(43-37)23-35(52-42)33-19-17-31(49-33)29-15-11-21-47-29)26(14-10-8-6-4-2)38-39(25)45-41-28(44-38)24-36(51-41)34-20-18-32(50-34)30-16-12-22-48-30/h11-12,15-24H,3-10,13-14H2,1-2H3 |
| InChIKey | AYSSFIOTXVIUFM-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.20 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|