C20H28O2S3 — CID 141147186
4,5-dihexyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide (PubChem CID 141147186) has the molecular formula C20H28O2S3 and a molecular weight of 396.64 g/mol. Its IUPAC name is 4,5-dihexyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide.
| Compound Name | 4,5-dihexyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide |
|---|---|
| PubChem CID | 141147186 |
| Molecular Formula | C20H28O2S3 |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4,5-dihexyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide |
| SMILES | CCCCCCc1sc2c(c1CCCCCC)S(=O)(=O)c1ccsc1-2 |
| InChI | InChI=1S/C20H28O2S3/c1-3-5-7-9-11-15-16(12-10-8-6-4-2)24-19-18-17(13-14-23-18)25(21,22)20(15)19/h13-14H,3-12H2,1-2H3 |
| InChIKey | OGKVVGRILZVLHG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|