About 2-hexylthiophen-3-ol
2-hexylthiophen-3-ol (PubChem CID 175348347) has the molecular formula C10H16OS
and a molecular weight of 184.30 g/mol. Its IUPAC name is 2-hexylthiophen-3-ol.
Molecular Properties
| Compound Name | 2-hexylthiophen-3-ol |
| PubChem CID | 175348347 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-hexylthiophen-3-ol |
| SMILES | CCCCCCc1sccc1O |
| InChI | InChI=1S/C10H16OS/c1-2-3-4-5-6-10-9(11)7-8-12-10/h7-8,11H,2-6H2,1H3 |
| InChIKey | MFNQFWSFDCGCTD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylthiophen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylthiophen-3-ol?
The IUPAC name of 2-hexylthiophen-3-ol (CID 175348347) is 2-hexylthiophen-3-ol.
What is the SMILES notation for 2-hexylthiophen-3-ol?
The canonical SMILES for 2-hexylthiophen-3-ol is CCCCCCc1sccc1O.
What is the InChIKey of 2-hexylthiophen-3-ol?
The InChIKey is MFNQFWSFDCGCTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16OS/c1-2-3-4-5-6-10-9(11)7-8-12-10/h7-8,11H,2-6H2,1H3.
What are the key properties of 2-hexylthiophen-3-ol?
2-hexylthiophen-3-ol has a molecular weight of 184.30 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylthiophen-3-ol is sourced from PubChem (CID 175348347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).