About 3-ethyl-2-hexylthiophene;N-methylmethanamine
3-ethyl-2-hexylthiophene;N-methylmethanamine (PubChem CID 142603185) has the molecular formula C14H27NS
and a molecular weight of 241.44 g/mol. Its IUPAC name is 3-ethyl-2-hexylthiophene;N-methylmethanamine.
Molecular Properties
| Compound Name | 3-ethyl-2-hexylthiophene;N-methylmethanamine |
| PubChem CID | 142603185 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 3-ethyl-2-hexylthiophene;N-methylmethanamine |
| SMILES | CCCCCCc1sccc1CC.CNC |
| InChI | InChI=1S/C12H20S.C2H7N/c1-3-5-6-7-8-12-11(4-2)9-10-13-12;1-3-2/h9-10H,3-8H2,1-2H3;3H,1-2H3 |
| InChIKey | WBBRRFQWBSXGCQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-hexylthiophene;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-hexylthiophene;N-methylmethanamine?
The IUPAC name of 3-ethyl-2-hexylthiophene;N-methylmethanamine (CID 142603185) is 3-ethyl-2-hexylthiophene;N-methylmethanamine.
What is the SMILES notation for 3-ethyl-2-hexylthiophene;N-methylmethanamine?
The canonical SMILES for 3-ethyl-2-hexylthiophene;N-methylmethanamine is CCCCCCc1sccc1CC.CNC.
What is the InChIKey of 3-ethyl-2-hexylthiophene;N-methylmethanamine?
The InChIKey is WBBRRFQWBSXGCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20S.C2H7N/c1-3-5-6-7-8-12-11(4-2)9-10-13-12;1-3-2/h9-10H,3-8H2,1-2H3;3H,1-2H3.
What are the key properties of 3-ethyl-2-hexylthiophene;N-methylmethanamine?
3-ethyl-2-hexylthiophene;N-methylmethanamine has a molecular weight of 241.44 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-hexylthiophene;N-methylmethanamine is sourced from PubChem (CID 142603185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).