C28H44O2S3 — CID 66924948
5,9-didecyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide (PubChem CID 66924948) has the molecular formula C28H44O2S3 and a molecular weight of 508.86 g/mol. Its IUPAC name is 5,9-didecyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide.
| Compound Name | 5,9-didecyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide |
|---|---|
| PubChem CID | 66924948 |
| Molecular Formula | C28H44O2S3 |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 5,9-didecyl-3,7λ6,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene 7,7-dioxide |
| SMILES | CCCCCCCCCCc1csc2c1S(=O)(=O)c1c(CCCCCCCCCC)csc1-2 |
| InChI | InChI=1S/C28H44O2S3/c1-3-5-7-9-11-13-15-17-19-23-21-31-25-26-28(33(29,30)27(23)25)24(22-32-26)20-18-16-14-12-10-8-6-4-2/h21-22H,3-20H2,1-2H3 |
| InChIKey | MTLVXLFLGFVNOY-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|