C36H45N3O2S4 — CID 102525009
(E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102525009) has the molecular formula C36H45N3O2S4 and a molecular weight of 680.04 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102525009 |
| Molecular Formula | C36H45N3O2S4 |
| Molecular Weight | 680.04 g/mol |
| Exact Mass | 679.24 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-nonyl-2-(4-nonyl-5-thiophen-2-yl-1,3-thiazol-2-yl)-1,3-thiazol-5-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCCCCc1nc(-c2nc(CCCCCCCCC)c(-c3ccc(/C=C(\C#N)C(=O)O)s3)s2)sc1-c1cccs1 |
| InChI | InChI=1S/C36H45N3O2S4/c1-3-5-7-9-11-13-15-18-28-32(30-20-17-23-42-30)44-34(38-28)35-39-29(19-16-14-12-10-8-6-4-2)33(45-35)31-22-21-27(43-31)24-26(25-37)36(40)41/h17,20-24H,3-16,18-19H2,1-2H3,(H,40,41)/b26-24+ |
| InChIKey | VTJGUPYGTVCVKK-SHHOIMCASA-N |
| XLogP | 12.30 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.04 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|