About 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine
5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine (PubChem CID 100969496) has the molecular formula C21H31Br2N3
and a molecular weight of 485.31 g/mol. Its IUPAC name is 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine |
| PubChem CID | 100969496 |
| Molecular Formula | C21H31Br2N3 |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine |
| SMILES | CCCCCCCc1nc2c(Br)cnc(Br)c2nc1CCCCCCC |
| InChI | InChI=1S/C21H31Br2N3/c1-3-5-7-9-11-13-17-18(14-12-10-8-6-4-2)26-20-19(25-17)16(22)15-24-21(20)23/h15H,3-14H2,1-2H3 |
| InChIKey | HZFFBGUUCWEHOD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine?
The IUPAC name of 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine (CID 100969496) is 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine.
What is the SMILES notation for 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine?
The canonical SMILES for 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine is CCCCCCCc1nc2c(Br)cnc(Br)c2nc1CCCCCCC.
What is the InChIKey of 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine?
The InChIKey is HZFFBGUUCWEHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31Br2N3/c1-3-5-7-9-11-13-17-18(14-12-10-8-6-4-2)26-20-19(25-17)16(22)15-24-21(20)23/h15H,3-14H2,1-2H3.
What are the key properties of 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine?
5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine has a molecular weight of 485.31 g/mol, XLogP of 7.58, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine is sourced from PubChem (CID 100969496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).