C21H31Br2N3 — CID 100969496
5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine (PubChem CID 100969496) has the molecular formula C21H31Br2N3 and a molecular weight of 485.31 g/mol. Its IUPAC name is 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine.
| Compound Name | 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 100969496 |
| Molecular Formula | C21H31Br2N3 |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 5,8-dibromo-2,3-diheptylpyrido[3,4-b]pyrazine |
| SMILES | CCCCCCCc1nc2c(Br)cnc(Br)c2nc1CCCCCCC |
| InChI | InChI=1S/C21H31Br2N3/c1-3-5-7-9-11-13-17-18(14-12-10-8-6-4-2)26-20-19(25-17)16(22)15-24-21(20)23/h15H,3-14H2,1-2H3 |
| InChIKey | HZFFBGUUCWEHOD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|