C19H27Br2N3 — CID 71427074
5,8-dibromo-2,3-dihexylpyrido[3,4-b]pyrazine (PubChem CID 71427074) has the molecular formula C19H27Br2N3 and a molecular weight of 457.25 g/mol. Its IUPAC name is 5,8-dibromo-2,3-dihexylpyrido[3,4-b]pyrazine.
| Compound Name | 5,8-dibromo-2,3-dihexylpyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 71427074 |
| Molecular Formula | C19H27Br2N3 |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 5,8-dibromo-2,3-dihexylpyrido[3,4-b]pyrazine |
| SMILES | CCCCCCc1nc2c(Br)cnc(Br)c2nc1CCCCCC |
| InChI | InChI=1S/C19H27Br2N3/c1-3-5-7-9-11-15-16(12-10-8-6-4-2)24-18-17(23-15)14(20)13-22-19(18)21/h13H,3-12H2,1-2H3 |
| InChIKey | GXRVMSMRNRZYDC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|