C24H16N2O2S2 — CID 102471258
(E)-2-cyano-3-[5-[5-(N-phenylanilino)thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 102471258) has the molecular formula C24H16N2O2S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5-(N-phenylanilino)thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5-(N-phenylanilino)thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102471258 |
| Molecular Formula | C24H16N2O2S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (E)-2-cyano-3-[5-[5-(N-phenylanilino)thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)s2)s1)C(=O)O |
| InChI | InChI=1S/C24H16N2O2S2/c25-16-17(24(27)28)15-20-11-12-21(29-20)22-13-14-23(30-22)26(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-15H,(H,27,28)/b17-15+ |
| InChIKey | FKOQXLUUHCJPKR-BMRADRMJSA-N |
| XLogP | 6.94 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|