C42H43N5O2 — CID 144684328
(Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]-5,6-diiminocyclohexa-1,3-dien-1-yl]-2-methylprop-2-enenitrile (PubChem CID 144684328) has the molecular formula C42H43N5O2 and a molecular weight of 649.84 g/mol. Its IUPAC name is (Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]-5,6-diiminocyclohexa-1,3-dien-1-yl]-2-methylprop-2-enenitrile.
| Compound Name | (Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]-5,6-diiminocyclohexa-1,3-dien-1-yl]-2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 144684328 |
| Molecular Formula | C42H43N5O2 |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | (Z)-3-[4-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]-5,6-diiminocyclohexa-1,3-dien-1-yl]-2-methylprop-2-enenitrile |
| SMILES | [H]/N=C1/C(c2ccc(/C=C/c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)n2CCCCCC)=CC=C(/C=C(/C)C#N)/C1=N\[H] |
| InChI | InChI=1S/C42H43N5O2/c1-5-6-7-8-27-46-33(20-26-40(46)39-25-12-32(28-30(2)29-43)41(44)42(39)45)13-9-31-10-14-34(15-11-31)47(35-16-21-37(48-3)22-17-35)36-18-23-38(49-4)24-19-36/h9-26,28,44-45H,5-8,27H2,1-4H3/b13-9+,30-28-,44-41+,45-42- |
| InChIKey | CLYJUTUDILVNKJ-YELSROOHSA-N |
| XLogP | 10.56 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|