C29H33N3O3 — CID 154601054
(E)-3-[3-(4-decoxyphenyl)-1-phenylpyrazol-4-yl]-2-isocyanoprop-2-enoic acid (PubChem CID 154601054) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is (E)-3-[3-(4-decoxyphenyl)-1-phenylpyrazol-4-yl]-2-isocyanoprop-2-enoic acid.
| Compound Name | (E)-3-[3-(4-decoxyphenyl)-1-phenylpyrazol-4-yl]-2-isocyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 154601054 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (E)-3-[3-(4-decoxyphenyl)-1-phenylpyrazol-4-yl]-2-isocyanoprop-2-enoic acid |
| SMILES | [C-]#[N+]/C(=C/c1cn(-c2ccccc2)nc1-c1ccc(OCCCCCCCCCC)cc1)C(=O)O |
| InChI | InChI=1S/C29H33N3O3/c1-3-4-5-6-7-8-9-13-20-35-26-18-16-23(17-19-26)28-24(21-27(30-2)29(33)34)22-32(31-28)25-14-11-10-12-15-25/h10-12,14-19,21-22H,3-9,13,20H2,1H3,(H,33,34)/b27-21+ |
| InChIKey | IEWRDVVKKXDZGK-SZXQPVLSSA-N |
| XLogP | 7.40 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|