C29H31ClN4O — CID 154601050
(E)-3-[1-(4-chlorophenyl)-3-(4-decoxyphenyl)pyrazol-4-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 154601050) has the molecular formula C29H31ClN4O and a molecular weight of 487.05 g/mol. Its IUPAC name is (E)-3-[1-(4-chlorophenyl)-3-(4-decoxyphenyl)pyrazol-4-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (E)-3-[1-(4-chlorophenyl)-3-(4-decoxyphenyl)pyrazol-4-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 154601050 |
| Molecular Formula | C29H31ClN4O |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (E)-3-[1-(4-chlorophenyl)-3-(4-decoxyphenyl)pyrazol-4-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C/c1cn(-c2ccc(Cl)cc2)nc1-c1ccc(OCCCCCCCCCC)cc1 |
| InChI | InChI=1S/C29H31ClN4O/c1-3-4-5-6-7-8-9-10-19-35-28-17-11-23(12-18-28)29-24(20-26(21-31)32-2)22-34(33-29)27-15-13-25(30)14-16-27/h11-18,20,22H,3-10,19H2,1H3/b26-20+ |
| InChIKey | XZNHJXNXVAVQBR-LHLOQNFPSA-N |
| XLogP | 8.50 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|