C26H25ClN2O2S2 — CID 158689045
(2Z)-2-[[1-(4-chlorophenyl)-3-(4-hexoxyphenyl)pyrazol-4-yl]methylidene]-5-sulfanylidenethiolan-3-one (PubChem CID 158689045) has the molecular formula C26H25ClN2O2S2 and a molecular weight of 497.09 g/mol. Its IUPAC name is (2Z)-2-[[1-(4-chlorophenyl)-3-(4-hexoxyphenyl)pyrazol-4-yl]methylidene]-5-sulfanylidenethiolan-3-one.
| Compound Name | (2Z)-2-[[1-(4-chlorophenyl)-3-(4-hexoxyphenyl)pyrazol-4-yl]methylidene]-5-sulfanylidenethiolan-3-one |
|---|---|
| PubChem CID | 158689045 |
| Molecular Formula | C26H25ClN2O2S2 |
| Molecular Weight | 497.09 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (2Z)-2-[[1-(4-chlorophenyl)-3-(4-hexoxyphenyl)pyrazol-4-yl]methylidene]-5-sulfanylidenethiolan-3-one |
| SMILES | CCCCCCOc1ccc(-c2nn(-c3ccc(Cl)cc3)cc2/C=C2\SC(=S)CC2=O)cc1 |
| InChI | InChI=1S/C26H25ClN2O2S2/c1-2-3-4-5-14-31-22-12-6-18(7-13-22)26-19(15-24-23(30)16-25(32)33-24)17-29(28-26)21-10-8-20(27)9-11-21/h6-13,15,17H,2-5,14,16H2,1H3/b24-15- |
| InChIKey | IGCNETFMNIWGNR-IWIPYMOSSA-N |
| XLogP | 7.53 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.09 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|