C27H22ClN3O3S — CID 18806319
(Z)-2-(4-chlorophenyl)sulfonyl-3-[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]prop-2-enenitrile (PubChem CID 18806319) has the molecular formula C27H22ClN3O3S and a molecular weight of 504.01 g/mol. Its IUPAC name is (Z)-2-(4-chlorophenyl)sulfonyl-3-[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-chlorophenyl)sulfonyl-3-[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 18806319 |
| Molecular Formula | C27H22ClN3O3S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | (Z)-2-(4-chlorophenyl)sulfonyl-3-[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]prop-2-enenitrile |
| SMILES | CCCOc1cccc(-c2nn(-c3ccccc3)cc2/C=C(/C#N)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H22ClN3O3S/c1-2-15-34-24-10-6-7-20(16-24)27-21(19-31(30-27)23-8-4-3-5-9-23)17-26(18-29)35(32,33)25-13-11-22(28)12-14-25/h3-14,16-17,19H,2,15H2,1H3/b26-17- |
| InChIKey | HTJHUAMJJPZRPA-ONUIUJJFSA-N |
| XLogP | 6.32 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|