C35H35N5O3S — CID 5269291
5-[[3-(4-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 5269291) has the molecular formula C35H35N5O3S and a molecular weight of 605.76 g/mol. Its IUPAC name is 5-[[3-(4-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[3-(4-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 5269291 |
| Molecular Formula | C35H35N5O3S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 5-[[3-(4-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CCCCCOc1ccc(-c2nc3sc(=Cc4cn(-c5ccccc5)nc4-c4ccc(OCCCC)cc4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C35H35N5O3S/c1-3-5-10-22-43-30-19-15-26(16-20-30)33-36-35-40(38-33)34(41)31(44-35)23-27-24-39(28-11-8-7-9-12-28)37-32(27)25-13-17-29(18-14-25)42-21-6-4-2/h7-9,11-20,23-24H,3-6,10,21-22H2,1-2H3 |
| InChIKey | GVOLDHFJJNMDJC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|