C32H29N5O2S — CID 5269186
5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-hexoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 5269186) has the molecular formula C32H29N5O2S and a molecular weight of 547.68 g/mol. Its IUPAC name is 5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-hexoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-hexoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 5269186 |
| Molecular Formula | C32H29N5O2S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 5-[(1,3-diphenylpyrazol-4-yl)methylidene]-2-(4-hexoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CCCCCCOc1ccc(-c2nc3sc(=Cc4cn(-c5ccccc5)nc4-c4ccccc4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C32H29N5O2S/c1-2-3-4-11-20-39-27-18-16-24(17-19-27)30-33-32-37(35-30)31(38)28(40-32)21-25-22-36(26-14-9-6-10-15-26)34-29(25)23-12-7-5-8-13-23/h5-10,12-19,21-22H,2-4,11,20H2,1H3 |
| InChIKey | ODIQTHBDANNZKZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|