C37H39N5O3S — CID 5269167
5-[[3-(4-hexoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 5269167) has the molecular formula C37H39N5O3S and a molecular weight of 633.82 g/mol. Its IUPAC name is 5-[[3-(4-hexoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[3-(4-hexoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 5269167 |
| Molecular Formula | C37H39N5O3S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | 5-[[3-(4-hexoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CCCCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(-c4ccc(OCCCCC)cc4)nn3c2=O)cc1 |
| InChI | InChI=1S/C37H39N5O3S/c1-3-5-7-12-24-45-31-19-15-27(16-20-31)34-29(26-41(39-34)30-13-9-8-10-14-30)25-33-36(43)42-37(46-33)38-35(40-42)28-17-21-32(22-18-28)44-23-11-6-4-2/h8-10,13-22,25-26H,3-7,11-12,23-24H2,1-2H3 |
| InChIKey | FGLYBFOTORXYJF-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|