C24H20O2S2 — CID 102027046
2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]thieno[3,2-b]thiophene (PubChem CID 102027046) has the molecular formula C24H20O2S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]thieno[3,2-b]thiophene.
| Compound Name | 2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 102027046 |
| Molecular Formula | C24H20O2S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2,5-bis[(E)-2-(4-methoxyphenyl)ethenyl]thieno[3,2-b]thiophene |
| SMILES | COc1ccc(/C=C/c2cc3sc(/C=C/c4ccc(OC)cc4)cc3s2)cc1 |
| InChI | InChI=1S/C24H20O2S2/c1-25-19-9-3-17(4-10-19)7-13-21-15-23-24(27-21)16-22(28-23)14-8-18-5-11-20(26-2)12-6-18/h3-16H,1-2H3/b13-7+,14-8+ |
| InChIKey | NFRKEIZKGQUULZ-FNCQTZNRSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |