About sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride
sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride (PubChem CID 173047029) has the molecular formula C17H15NaO2S
and a molecular weight of 306.36 g/mol. Its IUPAC name is sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride.
Molecular Properties
| Compound Name | sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride |
| PubChem CID | 173047029 |
| Molecular Formula | C17H15NaO2S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride |
| SMILES | COc1cc(O)cc(C=Cc2cc3ccccc3s2)c1.[H-].[Na+] |
| InChI | InChI=1S/C17H14O2S.Na.H/c1-19-15-9-12(8-14(18)11-15)6-7-16-10-13-4-2-3-5-17(13)20-16;;/h2-11,18H,1H3;;/q;+1;-1 |
| InChIKey | OVXQXFJETMPBJW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride?
The IUPAC name of sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride (CID 173047029) is sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride.
What is the SMILES notation for sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride?
The canonical SMILES for sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride is COc1cc(O)cc(C=Cc2cc3ccccc3s2)c1.[H-].[Na+].
What is the InChIKey of sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride?
The InChIKey is OVXQXFJETMPBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O2S.Na.H/c1-19-15-9-12(8-14(18)11-15)6-7-16-10-13-4-2-3-5-17(13)20-16;;/h2-11,18H,1H3;;/q;+1;-1.
What are the key properties of sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride?
sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride has a molecular weight of 306.36 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-[2-(1-benzothiophen-2-yl)ethenyl]-5-methoxyphenol;hydride is sourced from PubChem (CID 173047029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).