C12H10S — CID 150239976
2-buta-1,3-dienyl-1-benzothiophene (PubChem CID 150239976) has the molecular formula C12H10S and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-buta-1,3-dienyl-1-benzothiophene.
| Compound Name | 2-buta-1,3-dienyl-1-benzothiophene |
|---|---|
| PubChem CID | 150239976 |
| Molecular Formula | C12H10S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-buta-1,3-dienyl-1-benzothiophene |
| SMILES | C=CC=Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C12H10S/c1-2-3-7-11-9-10-6-4-5-8-12(10)13-11/h2-9H,1H2 |
| InChIKey | FXIFCWWPKLVQOO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|