C15H14O2S — CID 23650873
ethyl (2E,4E)-5-(1-benzothiophen-2-yl)penta-2,4-dienoate (PubChem CID 23650873) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(1-benzothiophen-2-yl)penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(1-benzothiophen-2-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 23650873 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | ethyl (2E,4E)-5-(1-benzothiophen-2-yl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H14O2S/c1-2-17-15(16)10-6-4-8-13-11-12-7-3-5-9-14(12)18-13/h3-11H,2H2,1H3/b8-4+,10-6+ |
| InChIKey | JKFFNNCTWGPGGH-GZFKCFCKSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|