C12H16N2O2S — CID 162429677
ethyl (2E,4E)-5-[2-(dimethylamino)-1,3-thiazol-5-yl]penta-2,4-dienoate (PubChem CID 162429677) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[2-(dimethylamino)-1,3-thiazol-5-yl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[2-(dimethylamino)-1,3-thiazol-5-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 162429677 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | ethyl (2E,4E)-5-[2-(dimethylamino)-1,3-thiazol-5-yl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/c1cnc(N(C)C)s1 |
| InChI | InChI=1S/C12H16N2O2S/c1-4-16-11(15)8-6-5-7-10-9-13-12(17-10)14(2)3/h5-9H,4H2,1-3H3/b7-5+,8-6+ |
| InChIKey | UENLGCDNGKJNHM-KQQUZDAGSA-N |
| XLogP | 2.34 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|