C25H35NO3S — CID 88856776
5-[(E)-2-[4-(dibutylamino)-2-(4-hydroxybutoxy)phenyl]ethenyl]thiophene-2-carbaldehyde (PubChem CID 88856776) has the molecular formula C25H35NO3S and a molecular weight of 429.63 g/mol. Its IUPAC name is 5-[(E)-2-[4-(dibutylamino)-2-(4-hydroxybutoxy)phenyl]ethenyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[(E)-2-[4-(dibutylamino)-2-(4-hydroxybutoxy)phenyl]ethenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 88856776 |
| Molecular Formula | C25H35NO3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 5-[(E)-2-[4-(dibutylamino)-2-(4-hydroxybutoxy)phenyl]ethenyl]thiophene-2-carbaldehyde |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccc(C=O)s2)c(OCCCCO)c1 |
| InChI | InChI=1S/C25H35NO3S/c1-3-5-15-26(16-6-4-2)22-11-9-21(25(19-22)29-18-8-7-17-27)10-12-23-13-14-24(20-28)30-23/h9-14,19-20,27H,3-8,15-18H2,1-2H3/b12-10+ |
| InChIKey | DZBOMZWSXHMJMH-ZRDIBKRKSA-N |
| XLogP | 6.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|