C34H45N5O2 — CID 118909832
2-[1-butyl-3-cyano-4-[(E)-2-[4-(dibutylamino)-2-hexoxyphenyl]ethenyl]-5-oxopyrrol-2-ylidene]propanedinitrile (PubChem CID 118909832) has the molecular formula C34H45N5O2 and a molecular weight of 555.77 g/mol. Its IUPAC name is 2-[1-butyl-3-cyano-4-[(E)-2-[4-(dibutylamino)-2-hexoxyphenyl]ethenyl]-5-oxopyrrol-2-ylidene]propanedinitrile.
| Compound Name | 2-[1-butyl-3-cyano-4-[(E)-2-[4-(dibutylamino)-2-hexoxyphenyl]ethenyl]-5-oxopyrrol-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 118909832 |
| Molecular Formula | C34H45N5O2 |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | 2-[1-butyl-3-cyano-4-[(E)-2-[4-(dibutylamino)-2-hexoxyphenyl]ethenyl]-5-oxopyrrol-2-ylidene]propanedinitrile |
| SMILES | CCCCCCOc1cc(N(CCCC)CCCC)ccc1/C=C/C1=C(C#N)C(=C(C#N)C#N)N(CCCC)C1=O |
| InChI | InChI=1S/C34H45N5O2/c1-5-9-13-14-22-41-32-23-29(38(19-10-6-2)20-11-7-3)17-15-27(32)16-18-30-31(26-37)33(28(24-35)25-36)39(34(30)40)21-12-8-4/h15-18,23H,5-14,19-22H2,1-4H3/b18-16+ |
| InChIKey | XINNZFWKUNANAV-FBMGVBCBSA-N |
| XLogP | 7.83 |
| TPSA | 104.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|