C39H40N4O4S — CID 138594042
2-[4-[(E)-2-[5-[(E)-2-[4-[bis(4-hydroxybutyl)amino]-2-phenylmethoxyphenyl]ethenyl]thiophen-2-yl]ethenyl]-3-cyano-5,5-dimethylfuran-2-ylidene]propanedinitrile (PubChem CID 138594042) has the molecular formula C39H40N4O4S and a molecular weight of 660.84 g/mol. Its IUPAC name is 2-[4-[(E)-2-[5-[(E)-2-[4-[bis(4-hydroxybutyl)amino]-2-phenylmethoxyphenyl]ethenyl]thiophen-2-yl]ethenyl]-3-cyano-5,5-dimethylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[4-[(E)-2-[5-[(E)-2-[4-[bis(4-hydroxybutyl)amino]-2-phenylmethoxyphenyl]ethenyl]thiophen-2-yl]ethenyl]-3-cyano-5,5-dimethylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 138594042 |
| Molecular Formula | C39H40N4O4S |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | 2-[4-[(E)-2-[5-[(E)-2-[4-[bis(4-hydroxybutyl)amino]-2-phenylmethoxyphenyl]ethenyl]thiophen-2-yl]ethenyl]-3-cyano-5,5-dimethylfuran-2-ylidene]propanedinitrile |
| SMILES | CC1(C)OC(=C(C#N)C#N)C(C#N)=C1/C=C/c1ccc(/C=C/c2ccc(N(CCCCO)CCCCO)cc2OCc2ccccc2)s1 |
| InChI | InChI=1S/C39H40N4O4S/c1-39(2)36(35(27-42)38(47-39)31(25-40)26-41)19-18-34-17-16-33(48-34)15-13-30-12-14-32(43(20-6-8-22-44)21-7-9-23-45)24-37(30)46-28-29-10-4-3-5-11-29/h3-5,10-19,24,44-45H,6-9,20-23,28H2,1-2H3/b15-13+,19-18+ |
| InChIKey | BTPREJMLBFGRPH-AXXMRAISSA-N |
| XLogP | 7.79 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|