C29H43I2N3 — CID 160715161
3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium diiodide (PubChem CID 160715161) has the molecular formula C29H43I2N3 and a molecular weight of 687.49 g/mol. Its IUPAC name is 3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium diiodide.
| Compound Name | 3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium diiodide |
|---|---|
| PubChem CID | 160715161 |
| Molecular Formula | C29H43I2N3 |
| Molecular Weight | 687.49 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | 3-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propyl-triethylazanium diiodide |
| SMILES | CC[N+](CC)(CC)CCC[N+]1=C(/C=C/c2ccc(N(C)C)cc2)C(C)(C)c2ccccc21.[I-].[I-] |
| InChI | InChI=1S/C29H43N3.2HI/c1-8-32(9-2,10-3)23-13-22-31-27-15-12-11-14-26(27)29(4,5)28(31)21-18-24-16-19-25(20-17-24)30(6)7;;/h11-12,14-21H,8-10,13,22-23H2,1-7H3;2*1H/q+2;;/p-2 |
| InChIKey | GFXXWELJOGRJNM-UHFFFAOYSA-L |
| XLogP | 0.12 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.49 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|