C36H44N4+2 — CID 59022261
4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 59022261) has the molecular formula C36H44N4+2 and a molecular weight of 532.78 g/mol. Its IUPAC name is 4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59022261 |
| Molecular Formula | C36H44N4+2 |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | 4-[2-[2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=CC2=[N+](C)c3cc4c(cc3C2(C)C)[N+](C)=C(C=Cc2ccc(N(C)C)cc2)C4(C)C)cc1 |
| InChI | InChI=1S/C36H44N4/c1-35(2)29-23-32-30(24-31(29)39(9)33(35)21-15-25-11-17-27(18-12-25)37(5)6)36(3,4)34(40(32)10)22-16-26-13-19-28(20-14-26)38(7)8/h11-24H,1-10H3/q+2 |
| InChIKey | HTXICOCCBBNDGJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|