C40H48N4+2 — CID 25031108
4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 25031108) has the molecular formula C40H48N4+2 and a molecular weight of 584.85 g/mol. Its IUPAC name is 4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 25031108 |
| Molecular Formula | C40H48N4+2 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | 4-[(1E,3E)-4-[2-[(1E,3E)-4-[4-(dimethylamino)phenyl]buta-1,3-dienyl]-1,3,3,5,7,7-hexamethylpyrrolo[2,3-f]indole-1,5-diium-6-yl]buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/C2=[N+](C)c3cc4c(cc3C2(C)C)[N+](C)=C(/C=C/C=C/c2ccc(N(C)C)cc2)C4(C)C)cc1 |
| InChI | InChI=1S/C40H48N4/c1-39(2)33-27-36-34(28-35(33)43(9)37(39)17-13-11-15-29-19-23-31(24-20-29)41(5)6)40(3,4)38(44(36)10)18-14-12-16-30-21-25-32(26-22-30)42(7)8/h11-28H,1-10H3/q+2 |
| InChIKey | YSTXWZAACIIWCK-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|