C25H27ClN2 — CID 14496852
N,N-dimethyl-4-[(E)-2-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)ethenyl]aniline chloride (PubChem CID 14496852) has the molecular formula C25H27ClN2 and a molecular weight of 390.96 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)ethenyl]aniline chloride.
| Compound Name | N,N-dimethyl-4-[(E)-2-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)ethenyl]aniline chloride |
|---|---|
| PubChem CID | 14496852 |
| Molecular Formula | C25H27ClN2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)ethenyl]aniline chloride |
| SMILES | CN(C)c1ccc(/C=C/C2=[N+](C)c3c(ccc4ccccc34)C2(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C25H27N2.ClH/c1-25(2)22-16-13-19-8-6-7-9-21(19)24(22)27(5)23(25)17-12-18-10-14-20(15-11-18)26(3)4;/h6-17H,1-5H3;1H/q+1;/p-1 |
| InChIKey | JVMZENJDRUSHFW-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|