C30H37N2+ — CID 153290921
4-[(E)-2-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 153290921) has the molecular formula C30H37N2+ and a molecular weight of 425.64 g/mol. Its IUPAC name is 4-[(E)-2-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 153290921 |
| Molecular Formula | C30H37N2+ |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 4-[(E)-2-(3-hexyl-1,1-dimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CCCCCC[N+]1=C(/C=C/c2ccc(N(C)C)cc2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C30H37N2/c1-6-7-8-11-22-32-27-20-17-24-12-9-10-13-26(24)29(27)30(2,3)28(32)21-16-23-14-18-25(19-15-23)31(4)5/h9-10,12-21H,6-8,11,22H2,1-5H3/q+1 |
| InChIKey | RYDBYRWVSGFNRZ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|