C26H29N2O2S+ — CID 142050164
N,N-dimethyl-4-[2-(1,1,3-trimethyl-7-methylsulfonylbenzo[e]indol-3-ium-2-yl)ethenyl]aniline (PubChem CID 142050164) has the molecular formula C26H29N2O2S+ and a molecular weight of 433.60 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(1,1,3-trimethyl-7-methylsulfonylbenzo[e]indol-3-ium-2-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(1,1,3-trimethyl-7-methylsulfonylbenzo[e]indol-3-ium-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 142050164 |
| Molecular Formula | C26H29N2O2S+ |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N,N-dimethyl-4-[2-(1,1,3-trimethyl-7-methylsulfonylbenzo[e]indol-3-ium-2-yl)ethenyl]aniline |
| SMILES | CN(C)c1ccc(C=CC2=[N+](C)c3ccc4cc(S(C)(=O)=O)ccc4c3C2(C)C)cc1 |
| InChI | InChI=1S/C26H29N2O2S/c1-26(2)24(16-9-18-7-11-20(12-8-18)27(3)4)28(5)23-15-10-19-17-21(31(6,29)30)13-14-22(19)25(23)26/h7-17H,1-6H3/q+1 |
| InChIKey | ODPPQQWMMBMIAS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|