C29H38N3O2S+ — CID 142050171
4-[2-[7-[dimethyl(nitro)-λ4-sulfanyl]-1,1,3-trimethylbenzo[e]indol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline;ethane (PubChem CID 142050171) has the molecular formula C29H38N3O2S+ and a molecular weight of 492.71 g/mol. Its IUPAC name is 4-[2-[7-[dimethyl(nitro)-λ4-sulfanyl]-1,1,3-trimethylbenzo[e]indol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline;ethane.
| Compound Name | 4-[2-[7-[dimethyl(nitro)-λ4-sulfanyl]-1,1,3-trimethylbenzo[e]indol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline;ethane |
|---|---|
| PubChem CID | 142050171 |
| Molecular Formula | C29H38N3O2S+ |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 4-[2-[7-[dimethyl(nitro)-λ4-sulfanyl]-1,1,3-trimethylbenzo[e]indol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline;ethane |
| SMILES | CC.CN(C)c1ccc(C=CC2=[N+](C)c3ccc4cc(S(C)(C)[N+](=O)[O-])ccc4c3C2(C)C)cc1 |
| InChI | InChI=1S/C27H32N3O2S.C2H6/c1-27(2)25(17-10-19-8-12-21(13-9-19)28(3)4)29(5)24-16-11-20-18-22(33(6,7)30(31)32)14-15-23(20)26(24)27;1-2/h8-18H,1-7H3;1-2H3/q+1; |
| InChIKey | RNUDIGWVRODWCB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|