C31H29N2+ — CID 118403597
2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium (PubChem CID 118403597) has the molecular formula C31H29N2+ and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium.
| Compound Name | 2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 118403597 |
| Molecular Formula | C31H29N2+ |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
| SMILES | CCn1c2ccccc2c2cc(/C=C/C3=[N+](C)c4ccc5ccccc5c4C3(C)C)ccc21 |
| InChI | InChI=1S/C31H29N2/c1-5-33-26-13-9-8-12-24(26)25-20-21(14-17-27(25)33)15-19-29-31(2,3)30-23-11-7-6-10-22(23)16-18-28(30)32(29)4/h6-20H,5H2,1-4H3/q+1 |
| InChIKey | XQXYFSQTOYCNMV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|