C28H31N2O2+ — CID 142050118
ethyl 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium-7-carboxylate (PubChem CID 142050118) has the molecular formula C28H31N2O2+ and a molecular weight of 427.57 g/mol. Its IUPAC name is ethyl 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium-7-carboxylate.
| Compound Name | ethyl 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium-7-carboxylate |
|---|---|
| PubChem CID | 142050118 |
| Molecular Formula | C28H31N2O2+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | ethyl 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium-7-carboxylate |
| SMILES | CCOC(=O)c1ccc2c3c(ccc2c1)[N+](C)=C(C=Cc1ccc(N(C)C)cc1)C3(C)C |
| InChI | InChI=1S/C28H31N2O2/c1-7-32-27(31)21-11-15-23-20(18-21)12-16-24-26(23)28(2,3)25(30(24)6)17-10-19-8-13-22(14-9-19)29(4)5/h8-18H,7H2,1-6H3/q+1 |
| InChIKey | UGKILBONFURJAW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|