C30H34IN2O+ — CID 161123894
4-[(E)-2-(1-butyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol iodide (PubChem CID 161123894) has the molecular formula C30H34IN2O+ and a molecular weight of 565.52 g/mol. Its IUPAC name is 4-[(E)-2-(1-butyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol iodide.
| Compound Name | 4-[(E)-2-(1-butyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol iodide |
|---|---|
| PubChem CID | 161123894 |
| Molecular Formula | C30H34IN2O+ |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 4-[(E)-2-(1-butyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenol iodide |
| SMILES | CCCC[N+]1=C(/C=C/c2ccc(O)c(/C=C/c3cc[n+](C)cc3)c2)C(C)(C)c2ccccc21.[I-] |
| InChI | InChI=1S/C30H33N2O.HI/c1-5-6-19-32-27-10-8-7-9-26(27)30(2,3)29(32)16-13-24-12-15-28(33)25(22-24)14-11-23-17-20-31(4)21-18-23;/h7-18,20-22H,5-6,19H2,1-4H3;1H/q+1; |
| InChIKey | ZHTFEPGMMXELDH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|